C23H36N2O2 — CID 158231391
2-tert-butylfuran;3-tert-butyl-1,2-oxazole;4-tert-butyl-2H-pyrrole (PubChem CID 158231391) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is 2-tert-butylfuran;3-tert-butyl-1,2-oxazole;4-tert-butyl-2H-pyrrole.
| Compound Name | 2-tert-butylfuran;3-tert-butyl-1,2-oxazole;4-tert-butyl-2H-pyrrole |
|---|---|
| PubChem CID | 158231391 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 2-tert-butylfuran;3-tert-butyl-1,2-oxazole;4-tert-butyl-2H-pyrrole |
| SMILES | CC(C)(C)C1=CCN=C1.CC(C)(C)c1ccco1.CC(C)(C)c1ccon1 |
| InChI | InChI=1S/C8H13N.C8H12O.C7H11NO/c1-8(2,3)7-4-5-9-6-7;1-8(2,3)7-5-4-6-9-7;1-7(2,3)6-4-5-9-8-6/h4,6H,5H2,1-3H3;4-6H,1-3H3;4-5H,1-3H3 |
| InChIKey | GEKRFGMYTWLKKB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 51.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |