C42H38F2OSe2 — CID 158232753
2-[4-(4-ethylphenyl)-2-fluorophenyl]-5-pent-1-enylselenophene;5-[4-(4-ethylphenyl)-2-fluorophenyl]selenophene-2-carbaldehyde (PubChem CID 158232753) has the molecular formula C42H38F2OSe2 and a molecular weight of 754.68 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)-2-fluorophenyl]-5-pent-1-enylselenophene;5-[4-(4-ethylphenyl)-2-fluorophenyl]selenophene-2-carbaldehyde.
| Compound Name | 2-[4-(4-ethylphenyl)-2-fluorophenyl]-5-pent-1-enylselenophene;5-[4-(4-ethylphenyl)-2-fluorophenyl]selenophene-2-carbaldehyde |
|---|---|
| PubChem CID | 158232753 |
| Molecular Formula | C42H38F2OSe2 |
| Molecular Weight | 754.68 g/mol |
| Exact Mass | 756.12 |
| IUPAC Name | 2-[4-(4-ethylphenyl)-2-fluorophenyl]-5-pent-1-enylselenophene;5-[4-(4-ethylphenyl)-2-fluorophenyl]selenophene-2-carbaldehyde |
| SMILES | CCCC=Cc1ccc(-c2ccc(-c3ccc(CC)cc3)cc2F)[se]1.CCc1ccc(-c2ccc(-c3ccc(C=O)[se]3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H23FSe.C19H15FOSe/c1-3-5-6-7-20-13-15-23(25-20)21-14-12-19(16-22(21)24)18-10-8-17(4-2)9-11-18;1-2-13-3-5-14(6-4-13)15-7-9-17(18(20)11-15)19-10-8-16(12-21)22-19/h6-16H,3-5H2,1-2H3;3-12H,2H2,1H3 |
| InChIKey | GEOUZOSLVPVONC-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.68 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|