About benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene
benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene (PubChem CID 158247145) has the molecular formula C28H29ClO4S2
and a molecular weight of 529.12 g/mol. Its IUPAC name is benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene.
Molecular Properties
| Compound Name | benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene |
| PubChem CID | 158247145 |
| Molecular Formula | C28H29ClO4S2 |
| Molecular Weight | 529.12 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccccc2)c(C)c1.Cc1cccc(C)c1.O=S(=O)(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H14O2S.C8H10.C6H5ClO2S/c1-11-8-9-14(12(2)10-11)17(15,16)13-6-4-3-5-7-13;1-7-4-3-5-8(2)6-7;7-10(8,9)6-4-2-1-3-5-6/h3-10H,1-2H3;3-6H,1-2H3;1-5H |
| InChIKey | GGGIYIRTVKYUQZ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.12 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene?
The IUPAC name of benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene (CID 158247145) is benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene.
What is the SMILES notation for benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene?
The canonical SMILES for benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene is Cc1ccc(S(=O)(=O)c2ccccc2)c(C)c1.Cc1cccc(C)c1.O=S(=O)(Cl)c1ccccc1.
What is the InChIKey of benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene?
The InChIKey is GGGIYIRTVKYUQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2S.C8H10.C6H5ClO2S/c1-11-8-9-14(12(2)10-11)17(15,16)13-6-4-3-5-7-13;1-7-4-3-5-8(2)6-7;7-10(8,9)6-4-2-1-3-5-6/h3-10H,1-2H3;3-6H,1-2H3;1-5H.
What are the key properties of benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene?
benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene has a molecular weight of 529.12 g/mol, XLogP of 7.05, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonyl chloride;1-(benzenesulfonyl)-2,4-dimethylbenzene;1,3-xylene is sourced from PubChem (CID 158247145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).