C14H16FN — CID 158248898
(2S)-8-fluoro-2,5-dimethyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 158248898) has the molecular formula C14H16FN and a molecular weight of 217.29 g/mol. Its IUPAC name is (2S)-8-fluoro-2,5-dimethyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | (2S)-8-fluoro-2,5-dimethyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 158248898 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (2S)-8-fluoro-2,5-dimethyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | Cc1ccc(F)c2[nH]c3c(c12)CC[C@H](C)C3 |
| InChI | InChI=1S/C14H16FN/c1-8-3-5-10-12(7-8)16-14-11(15)6-4-9(2)13(10)14/h4,6,8,16H,3,5,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | GGLSUVUGZRNKEA-QMMMGPOBSA-N |
| XLogP | 3.74 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |