C13H14FN — CID 139234350
7-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 139234350) has the molecular formula C13H14FN and a molecular weight of 203.26 g/mol. Its IUPAC name is 7-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 7-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 139234350 |
| Molecular Formula | C13H14FN |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 7-fluoro-8-methyl-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | Cc1c(F)ccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C13H14FN/c1-8-11(14)7-6-10-9-4-2-3-5-12(9)15-13(8)10/h6-7,15H,2-5H2,1H3 |
| InChIKey | IXXSTMOXHNDJIE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|