C13H13F2NO — CID 135002782
8-(difluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 135002782) has the molecular formula C13H13F2NO and a molecular weight of 237.25 g/mol. Its IUPAC name is 8-(difluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 8-(difluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 135002782 |
| Molecular Formula | C13H13F2NO |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 8-(difluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | FC(F)Oc1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C13H13F2NO/c14-13(15)17-11-7-3-5-9-8-4-1-2-6-10(8)16-12(9)11/h3,5,7,13,16H,1-2,4,6H2 |
| InChIKey | VUNZYLUVOLEPOS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|