C18H36O7 — CID 158250745
[3-(2,2-diethoxyethyl)oxiran-2-yl]methanol;(E)-5,5-diethoxypent-2-en-1-ol (PubChem CID 158250745) has the molecular formula C18H36O7 and a molecular weight of 364.48 g/mol. Its IUPAC name is [3-(2,2-diethoxyethyl)oxiran-2-yl]methanol;(E)-5,5-diethoxypent-2-en-1-ol.
| Compound Name | [3-(2,2-diethoxyethyl)oxiran-2-yl]methanol;(E)-5,5-diethoxypent-2-en-1-ol |
|---|---|
| PubChem CID | 158250745 |
| Molecular Formula | C18H36O7 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | [3-(2,2-diethoxyethyl)oxiran-2-yl]methanol;(E)-5,5-diethoxypent-2-en-1-ol |
| SMILES | CCOC(C/C=C/CO)OCC.CCOC(CC1OC1CO)OCC |
| InChI | InChI=1S/C9H18O4.C9H18O3/c1-3-11-9(12-4-2)5-7-8(6-10)13-7;1-3-11-9(12-4-2)7-5-6-8-10/h7-10H,3-6H2,1-2H3;5-6,9-10H,3-4,7-8H2,1-2H3/b;6-5+ |
| InChIKey | GGRLBZCJASYTFK-MXDQRGINSA-N |
| XLogP | 1.86 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|