C17H17N3 — CID 158254975
2-(4-pyrrolidin-1-ylphenyl)-3H-pyrrolo[2,3-c]pyridine (PubChem CID 158254975) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-(4-pyrrolidin-1-ylphenyl)-3H-pyrrolo[2,3-c]pyridine.
| Compound Name | 2-(4-pyrrolidin-1-ylphenyl)-3H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 158254975 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-(4-pyrrolidin-1-ylphenyl)-3H-pyrrolo[2,3-c]pyridine |
| SMILES | c1cc2c(cn1)N=C(c1ccc(N3CCCC3)cc1)C2 |
| InChI | InChI=1S/C17H17N3/c1-2-10-20(9-1)15-5-3-13(4-6-15)16-11-14-7-8-18-12-17(14)19-16/h3-8,12H,1-2,9-11H2 |
| InChIKey | GHECEPATSZRQNL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |