C29H49F6NO6 — CID 158255250
tert-butyl 4-(2,2-dimethylbutanoyloxy)piperidine-1-carboxylate;[4,4,4-trifluoro-2,3-dimethyl-3-(trifluoromethyl)butan-2-yl] 2,2-dimethylbutanoate (PubChem CID 158255250) has the molecular formula C29H49F6NO6 and a molecular weight of 621.70 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dimethylbutanoyloxy)piperidine-1-carboxylate;[4,4,4-trifluoro-2,3-dimethyl-3-(trifluoromethyl)butan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | tert-butyl 4-(2,2-dimethylbutanoyloxy)piperidine-1-carboxylate;[4,4,4-trifluoro-2,3-dimethyl-3-(trifluoromethyl)butan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158255250 |
| Molecular Formula | C29H49F6NO6 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.35 |
| IUPAC Name | tert-butyl 4-(2,2-dimethylbutanoyloxy)piperidine-1-carboxylate;[4,4,4-trifluoro-2,3-dimethyl-3-(trifluoromethyl)butan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)C(C)(C(F)(F)F)C(F)(F)F.CCC(C)(C)C(=O)OC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29NO4.C13H20F6O2/c1-7-16(5,6)13(18)20-12-8-10-17(11-9-12)14(19)21-15(2,3)4;1-7-9(2,3)8(20)21-10(4,5)11(6,12(14,15)16)13(17,18)19/h12H,7-11H2,1-6H3;7H2,1-6H3 |
| InChIKey | GHEYKEAZYLCKBM-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|