C33H26F4I2O10 — CID 158262116
5-(2,4-difluorophenyl)-3-iodo-2-methylbenzoic acid;5-(2,4-difluorophenyl)-3-iodo-2-[(2S,3S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid (PubChem CID 158262116) has the molecular formula C33H26F4I2O10 and a molecular weight of 912.36 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-3-iodo-2-methylbenzoic acid;5-(2,4-difluorophenyl)-3-iodo-2-[(2S,3S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid.
| Compound Name | 5-(2,4-difluorophenyl)-3-iodo-2-methylbenzoic acid;5-(2,4-difluorophenyl)-3-iodo-2-[(2S,3S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 158262116 |
| Molecular Formula | C33H26F4I2O10 |
| Molecular Weight | 912.36 g/mol |
| Exact Mass | 911.96 |
| IUPAC Name | 5-(2,4-difluorophenyl)-3-iodo-2-methylbenzoic acid;5-(2,4-difluorophenyl)-3-iodo-2-[(2S,3S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzoic acid |
| SMILES | Cc1c(I)cc(-c2ccc(F)cc2F)cc1C(=O)O.O=C(O)c1cc(-c2ccc(F)cc2F)cc(I)c1O[C@@H]1OC(CO)[C@@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C19H17F2IO8.C14H9F2IO2/c20-8-1-2-9(11(21)5-8)7-3-10(18(27)28)17(12(22)4-7)30-19-16(26)15(25)14(24)13(6-23)29-19;1-7-11(14(18)19)4-8(5-13(7)17)10-3-2-9(15)6-12(10)16/h1-5,13-16,19,23-26H,6H2,(H,27,28);2-6H,1H3,(H,18,19)/t13?,14-,15?,16+,19+;/m1./s1 |
| InChIKey | GHZNUKXWNGKBHI-YCVJERHHSA-N |
| XLogP | 5.36 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|