C8H10N2O7 — CID 158264902
1-methyl-1,3-diazinane-2,4,6-trione;propanedioic acid (PubChem CID 158264902) has the molecular formula C8H10N2O7 and a molecular weight of 246.17 g/mol. Its IUPAC name is 1-methyl-1,3-diazinane-2,4,6-trione;propanedioic acid.
| Compound Name | 1-methyl-1,3-diazinane-2,4,6-trione;propanedioic acid |
|---|---|
| PubChem CID | 158264902 |
| Molecular Formula | C8H10N2O7 |
| Molecular Weight | 246.17 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-methyl-1,3-diazinane-2,4,6-trione;propanedioic acid |
| SMILES | CN1C(=O)CC(=O)NC1=O.O=C(O)CC(=O)O |
| InChI | InChI=1S/C5H6N2O3.C3H4O4/c1-7-4(9)2-3(8)6-5(7)10;4-2(5)1-3(6)7/h2H2,1H3,(H,6,8,10);1H2,(H,4,5)(H,6,7) |
| InChIKey | GIHXIDNZPWKMEF-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.17 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|