C35H40O8 — CID 158267909
3-[2-[4-methyl-3-[2-oxo-2-[3-(3-phenylpropanoyloxy)propoxy]ethyl]phenyl]acetyl]oxypropyl 3-phenylpropanoate (PubChem CID 158267909) has the molecular formula C35H40O8 and a molecular weight of 588.70 g/mol. Its IUPAC name is 3-[2-[4-methyl-3-[2-oxo-2-[3-(3-phenylpropanoyloxy)propoxy]ethyl]phenyl]acetyl]oxypropyl 3-phenylpropanoate.
| Compound Name | 3-[2-[4-methyl-3-[2-oxo-2-[3-(3-phenylpropanoyloxy)propoxy]ethyl]phenyl]acetyl]oxypropyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 158267909 |
| Molecular Formula | C35H40O8 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 3-[2-[4-methyl-3-[2-oxo-2-[3-(3-phenylpropanoyloxy)propoxy]ethyl]phenyl]acetyl]oxypropyl 3-phenylpropanoate |
| SMILES | Cc1ccc(CC(=O)OCCCOC(=O)CCc2ccccc2)cc1CC(=O)OCCCOC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C35H40O8/c1-27-14-15-30(25-34(38)42-22-8-20-40-32(36)18-16-28-10-4-2-5-11-28)24-31(27)26-35(39)43-23-9-21-41-33(37)19-17-29-12-6-3-7-13-29/h2-7,10-15,24H,8-9,16-23,25-26H2,1H3 |
| InChIKey | IOIDTCBYDVSZJM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|