C19H18O2 — CID 158276826
2-hydroxy-1-(17-tetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaenyl)ethanone (PubChem CID 158276826) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-hydroxy-1-(17-tetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaenyl)ethanone.
| Compound Name | 2-hydroxy-1-(17-tetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaenyl)ethanone |
|---|---|
| PubChem CID | 158276826 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-hydroxy-1-(17-tetracyclo[7.6.2.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaenyl)ethanone |
| SMILES | O=C(CO)C1CC2c3ccccc3CC1c1ccccc12 |
| InChI | InChI=1S/C19H18O2/c20-11-19(21)18-10-17-13-6-2-1-5-12(13)9-16(18)14-7-3-4-8-15(14)17/h1-8,16-18,20H,9-11H2 |
| InChIKey | JDPFGUPDORKIGX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |