C41H78N16O6 — CID 158280576
17-(diaminomethylideneamino)-2,5,8,11-tetrakis[3-(diaminomethylideneamino)propyl]-14-ethyl-N-(3-methyl-2-oxobutyl)-4,7,10,13-tetraoxoheptadecanamide (PubChem CID 158280576) has the molecular formula C41H78N16O6 and a molecular weight of 891.18 g/mol. Its IUPAC name is 17-(diaminomethylideneamino)-2,5,8,11-tetrakis[3-(diaminomethylideneamino)propyl]-14-ethyl-N-(3-methyl-2-oxobutyl)-4,7,10,13-tetraoxoheptadecanamide.
| Compound Name | 17-(diaminomethylideneamino)-2,5,8,11-tetrakis[3-(diaminomethylideneamino)propyl]-14-ethyl-N-(3-methyl-2-oxobutyl)-4,7,10,13-tetraoxoheptadecanamide |
|---|---|
| PubChem CID | 158280576 |
| Molecular Formula | C41H78N16O6 |
| Molecular Weight | 891.18 g/mol |
| Exact Mass | 890.63 |
| IUPAC Name | 17-(diaminomethylideneamino)-2,5,8,11-tetrakis[3-(diaminomethylideneamino)propyl]-14-ethyl-N-(3-methyl-2-oxobutyl)-4,7,10,13-tetraoxoheptadecanamide |
| SMILES | CCC(CCCN=C(N)N)C(=O)CC(CCCN=C(N)N)C(=O)CC(CCCN=C(N)N)C(=O)CC(CCCN=C(N)N)C(=O)CC(CCCN=C(N)N)C(=O)NCC(=O)C(C)C |
| InChI | InChI=1S/C41H78N16O6/c1-4-26(10-5-15-52-37(42)43)31(58)20-27(11-6-16-53-38(44)45)32(59)21-28(12-7-17-54-39(46)47)33(60)22-29(13-8-18-55-40(48)49)34(61)23-30(14-9-19-56-41(50)51)36(63)57-24-35(62)25(2)3/h25-30H,4-24H2,1-3H3,(H,57,63)(H4,42,43,52)(H4,44,45,53)(H4,46,47,54)(H4,48,49,55)(H4,50,51,56) |
| InChIKey | DJFVWFVRRGSEMN-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 436.45 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.18 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|