C16H28N6O7 — CID 58330370
6-[[5-aminooxy-2-[3-(diaminomethylideneamino)propyl]-4-oxopentanoyl]amino]-3-carbamoyl-5-oxohexanoic acid (PubChem CID 58330370) has the molecular formula C16H28N6O7 and a molecular weight of 416.44 g/mol. Its IUPAC name is 6-[[5-aminooxy-2-[3-(diaminomethylideneamino)propyl]-4-oxopentanoyl]amino]-3-carbamoyl-5-oxohexanoic acid.
| Compound Name | 6-[[5-aminooxy-2-[3-(diaminomethylideneamino)propyl]-4-oxopentanoyl]amino]-3-carbamoyl-5-oxohexanoic acid |
|---|---|
| PubChem CID | 58330370 |
| Molecular Formula | C16H28N6O7 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 6-[[5-aminooxy-2-[3-(diaminomethylideneamino)propyl]-4-oxopentanoyl]amino]-3-carbamoyl-5-oxohexanoic acid |
| SMILES | NOCC(=O)CC(CCCN=C(N)N)C(=O)NCC(=O)CC(CC(=O)O)C(N)=O |
| InChI | InChI=1S/C16H28N6O7/c17-14(27)10(6-13(25)26)5-11(23)7-22-15(28)9(4-12(24)8-29-20)2-1-3-21-16(18)19/h9-10H,1-8,20H2,(H2,17,27)(H,22,28)(H,25,26)(H4,18,19,21) |
| InChIKey | IBNGTDYLWUFCSM-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 243.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|