C35H58FN5O8Si — CID 158282823
(2R)-10-[[(5R)-5-[[(2R)-2-amino-3-[[4-[ditert-butyl(fluoro)silyl]benzoyl]amino]propanoyl]amino]-5-carboxypentyl]amino]-2-(methylamino)-7,10-dioxodecanoic acid (PubChem CID 158282823) has the molecular formula C35H58FN5O8Si and a molecular weight of 723.96 g/mol. Its IUPAC name is (2R)-10-[[(5R)-5-[[(2R)-2-amino-3-[[4-[ditert-butyl(fluoro)silyl]benzoyl]amino]propanoyl]amino]-5-carboxypentyl]amino]-2-(methylamino)-7,10-dioxodecanoic acid.
| Compound Name | (2R)-10-[[(5R)-5-[[(2R)-2-amino-3-[[4-[ditert-butyl(fluoro)silyl]benzoyl]amino]propanoyl]amino]-5-carboxypentyl]amino]-2-(methylamino)-7,10-dioxodecanoic acid |
|---|---|
| PubChem CID | 158282823 |
| Molecular Formula | C35H58FN5O8Si |
| Molecular Weight | 723.96 g/mol |
| Exact Mass | 723.40 |
| IUPAC Name | (2R)-10-[[(5R)-5-[[(2R)-2-amino-3-[[4-[ditert-butyl(fluoro)silyl]benzoyl]amino]propanoyl]amino]-5-carboxypentyl]amino]-2-(methylamino)-7,10-dioxodecanoic acid |
| SMILES | CN[C@H](CCCCC(=O)CCC(=O)NCCCC[C@@H](NC(=O)[C@H](N)CNC(=O)c1ccc([Si](F)(C(C)(C)C)C(C)(C)C)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C35H58FN5O8Si/c1-34(2,3)50(36,35(4,5)6)25-18-15-23(16-19-25)30(44)40-22-26(37)31(45)41-28(33(48)49)14-10-11-21-39-29(43)20-17-24(42)12-8-9-13-27(38-7)32(46)47/h15-16,18-19,26-28,38H,8-14,17,20-22,37H2,1-7H3,(H,39,43)(H,40,44)(H,41,45)(H,46,47)(H,48,49)/t26-,27-,28-/m1/s1 |
| InChIKey | GKKKZJUUNWQIIX-JCYYIGJDSA-N |
| XLogP | 2.90 |
| TPSA | 217.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.96 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|