C11H14BClO2 — CID 15828376
(5R)-2-(chloromethyl)-4,4-dimethyl-5-phenyl-1,3,2-dioxaborolane (PubChem CID 15828376) has the molecular formula C11H14BClO2 and a molecular weight of 224.50 g/mol. Its IUPAC name is (5R)-2-(chloromethyl)-4,4-dimethyl-5-phenyl-1,3,2-dioxaborolane.
| Compound Name | (5R)-2-(chloromethyl)-4,4-dimethyl-5-phenyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 15828376 |
| Molecular Formula | C11H14BClO2 |
| Molecular Weight | 224.50 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (5R)-2-(chloromethyl)-4,4-dimethyl-5-phenyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(CCl)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H14BClO2/c1-11(2)10(14-12(8-13)15-11)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3/t10-/m1/s1 |
| InChIKey | ROFRBYNDMMXWGO-SNVBAGLBSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|