C21H34FN3O2S — CID 158287261
1-[5-(cyclohexylmethylsulfonyl)pentyl]-4-(6-fluoro-2-pyridinyl)piperazine (PubChem CID 158287261) has the molecular formula C21H34FN3O2S and a molecular weight of 411.59 g/mol. Its IUPAC name is 1-[5-(cyclohexylmethylsulfonyl)pentyl]-4-(6-fluoro-2-pyridinyl)piperazine.
| Compound Name | 1-[5-(cyclohexylmethylsulfonyl)pentyl]-4-(6-fluoro-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 158287261 |
| Molecular Formula | C21H34FN3O2S |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[5-(cyclohexylmethylsulfonyl)pentyl]-4-(6-fluoro-2-pyridinyl)piperazine |
| SMILES | O=S(=O)(CCCCCN1CCN(c2cccc(F)n2)CC1)CC1CCCCC1 |
| InChI | InChI=1S/C21H34FN3O2S/c22-20-10-7-11-21(23-20)25-15-13-24(14-16-25)12-5-2-6-17-28(26,27)18-19-8-3-1-4-9-19/h7,10-11,19H,1-6,8-9,12-18H2 |
| InChIKey | VYELJKPHOWLWPD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|