C19H20O5 — CID 158294371
methyl (2R)-2-benzyl-4-(2,6-dihydroxy-4-methylphenyl)-4-oxobutanoate (PubChem CID 158294371) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is methyl (2R)-2-benzyl-4-(2,6-dihydroxy-4-methylphenyl)-4-oxobutanoate.
| Compound Name | methyl (2R)-2-benzyl-4-(2,6-dihydroxy-4-methylphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 158294371 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | methyl (2R)-2-benzyl-4-(2,6-dihydroxy-4-methylphenyl)-4-oxobutanoate |
| SMILES | COC(=O)[C@@H](CC(=O)c1c(O)cc(C)cc1O)Cc1ccccc1 |
| InChI | InChI=1S/C19H20O5/c1-12-8-15(20)18(16(21)9-12)17(22)11-14(19(23)24-2)10-13-6-4-3-5-7-13/h3-9,14,20-21H,10-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | GLSONSLDKGVYTL-CQSZACIVSA-N |
| XLogP | 3.01 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |