C21H19FN2O4 — CID 161392110
methyl 2-benzyl-4-[3-(5-fluoro-2-hydroxyphenyl)-1H-pyrazol-5-yl]-4-oxobutanoate (PubChem CID 161392110) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is methyl 2-benzyl-4-[3-(5-fluoro-2-hydroxyphenyl)-1H-pyrazol-5-yl]-4-oxobutanoate.
| Compound Name | methyl 2-benzyl-4-[3-(5-fluoro-2-hydroxyphenyl)-1H-pyrazol-5-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 161392110 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | methyl 2-benzyl-4-[3-(5-fluoro-2-hydroxyphenyl)-1H-pyrazol-5-yl]-4-oxobutanoate |
| SMILES | COC(=O)C(CC(=O)c1cc(-c2cc(F)ccc2O)n[nH]1)Cc1ccccc1 |
| InChI | InChI=1S/C21H19FN2O4/c1-28-21(27)14(9-13-5-3-2-4-6-13)10-20(26)18-12-17(23-24-18)16-11-15(22)7-8-19(16)25/h2-8,11-12,14,25H,9-10H2,1H3,(H,23,24) |
| InChIKey | AFKCRRQXKHTNCU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |