C13H16N5O6P — CID 158306031
[(2R,3S,5R)-3-hydroxy-5-(imidazo[2,1-f]purin-3-ylmethyl)oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 158306031) has the molecular formula C13H16N5O6P and a molecular weight of 369.27 g/mol. Its IUPAC name is [(2R,3S,5R)-3-hydroxy-5-(imidazo[2,1-f]purin-3-ylmethyl)oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-3-hydroxy-5-(imidazo[2,1-f]purin-3-ylmethyl)oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 158306031 |
| Molecular Formula | C13H16N5O6P |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [(2R,3S,5R)-3-hydroxy-5-(imidazo[2,1-f]purin-3-ylmethyl)oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1O[C@@H](Cn2cnc3c2ncn2ccnc32)C[C@@H]1O |
| InChI | InChI=1S/C13H16N5O6P/c19-9-3-8(24-10(9)5-23-25(20,21)22)4-18-6-15-11-12-14-1-2-17(12)7-16-13(11)18/h1-2,6-10,19H,3-5H2,(H2,20,21,22)/t8-,9+,10-/m1/s1 |
| InChIKey | GNCAAKWAGCTTSO-KXUCPTDWSA-N |
| XLogP | -0.29 |
| TPSA | 144.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|