C19H21F6N7O3P- — CID 158310417
benzotriazol-1-yl N-ethyl-2-(methylamino)ethanimidate;1H-indazole-3-carboxylic acid;hexafluorophosphate (PubChem CID 158310417) has the molecular formula C19H21F6N7O3P- and a molecular weight of 540.39 g/mol. Its IUPAC name is benzotriazol-1-yl N-ethyl-2-(methylamino)ethanimidate;1H-indazole-3-carboxylic acid;hexafluorophosphate.
| Compound Name | benzotriazol-1-yl N-ethyl-2-(methylamino)ethanimidate;1H-indazole-3-carboxylic acid;hexafluorophosphate |
|---|---|
| PubChem CID | 158310417 |
| Molecular Formula | C19H21F6N7O3P- |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | benzotriazol-1-yl N-ethyl-2-(methylamino)ethanimidate;1H-indazole-3-carboxylic acid;hexafluorophosphate |
| SMILES | CC/N=C(\CNC)On1nnc2ccccc21.F[P-](F)(F)(F)(F)F.O=C(O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C11H15N5O.C8H6N2O2.F6P/c1-3-13-11(8-12-2)17-16-10-7-5-4-6-9(10)14-15-16;11-8(12)7-5-3-1-2-4-6(5)9-10-7;1-7(2,3,4,5)6/h4-7,12H,3,8H2,1-2H3;1-4H,(H,9,10)(H,11,12);/q;;-1/b13-11+;; |
| InChIKey | CTGVBTCJGAJEBE-UAIOKUCGSA-N |
| XLogP | 5.14 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|