C29H42Cl2O4 — CID 158311711
3,5-ditert-butyl-2-chloro-6-hydroxybenzoic acid;2,4-ditert-butyl-5-chlorophenol (PubChem CID 158311711) has the molecular formula C29H42Cl2O4 and a molecular weight of 525.56 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-chloro-6-hydroxybenzoic acid;2,4-ditert-butyl-5-chlorophenol.
| Compound Name | 3,5-ditert-butyl-2-chloro-6-hydroxybenzoic acid;2,4-ditert-butyl-5-chlorophenol |
|---|---|
| PubChem CID | 158311711 |
| Molecular Formula | C29H42Cl2O4 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3,5-ditert-butyl-2-chloro-6-hydroxybenzoic acid;2,4-ditert-butyl-5-chlorophenol |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(Cl)c(C(=O)O)c1O.CC(C)(C)c1cc(C(C)(C)C)c(Cl)cc1O |
| InChI | InChI=1S/C15H21ClO3.C14H21ClO/c1-14(2,3)8-7-9(15(4,5)6)12(17)10(11(8)16)13(18)19;1-13(2,3)9-7-10(14(4,5)6)12(16)8-11(9)15/h7,17H,1-6H3,(H,18,19);7-8,16H,1-6H3 |
| InChIKey | GNTISEYBZBBFOV-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |