C76H54BClN15O31 — CID 158313118
CID 158313118 (PubChem CID 158313118) has the molecular formula C76H54BClN15O31 and a molecular weight of 1719.61 g/mol.
| Compound Name | CID 158313118 |
|---|---|
| PubChem CID | 158313118 |
| Molecular Formula | C76H54BClN15O31 |
| Molecular Weight | 1719.61 g/mol |
| Exact Mass | 1718.29 |
| IUPAC Name | — |
| SMILES | CC[C@@]1(OC(=O)[C@@H](C)ON=C2c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3-c3c2cc([N+](=O)[O-])cc3[N+](=O)[O-])C(=O)OCc2c1cc1n(c2=O)Cc2cc3c(CN(C)C)c(O)ccc3nc2-1.CC[C@@]1(OC(=O)[C@@H](C)ON=C2c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3-c3c2cc([N+](=O)[O-])cc3[N+](=O)[O-])C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc([B]OC=O)ccc3nc2-1.Cl |
| InChI | InChI=1S/C39H30N8O15.C37H23BN7O16.ClH/c1-5-39(26-13-30-34-18(14-43(30)36(49)25(26)16-60-38(39)51)8-21-24(15-42(3)4)31(48)7-6-27(21)40-34)61-37(50)17(2)62-41-35-22-9-19(44(52)53)11-28(46(56)57)32(22)33-23(35)10-20(45(54)55)12-29(33)47(58)59;1-3-37(25-12-29-32-18(13-41(29)34(47)24(25)14-58-36(37)49)6-17-7-19(38-59-15-46)4-5-26(17)39-32)60-35(48)16(2)61-40-33-22-8-20(42(50)51)10-27(44(54)55)30(22)31-23(33)9-21(43(52)53)11-28(31)45(56)57;/h6-13,17,48H,5,14-16H2,1-4H3;4-12,15-16H,3,13-14H2,1-2H3;1H/t17-,39+;16-,37+;/m11./s1 |
| InChIKey | ZLNGOYDSJXBTRZ-JQDYOMPDSA-N |
| XLogP | 8.81 |
| TPSA | 613.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 38 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 124 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1719.61 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 38 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|