C74H48B2N14O33 — CID 172956957
CID 172956957 (PubChem CID 172956957) has the molecular formula C74H48B2N14O33 and a molecular weight of 1682.89 g/mol.
| Compound Name | CID 172956957 |
|---|---|
| PubChem CID | 172956957 |
| Molecular Formula | C74H48B2N14O33 |
| Molecular Weight | 1682.89 g/mol |
| Exact Mass | 1682.27 |
| IUPAC Name | — |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc(C(=O)B=O)ccc3nc2-1.C[C@H](ON=C1c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)O.[B]C(=O)Oc1ccc2nc3c(cc2c1)Cn1c-3cc2c(c1=O)COC(=O)[C@@]2(CC)OC(=O)[C@H](C)O/N=C1/c2cc([N+](=O)[O-])cc(OON)c2-c2c1cc([N+](=O)[O-])cc2[N+](=O)[O-] |
| InChI | InChI=1S/C37H24BN7O16.C21H15BN2O6.C16H9N5O11/c1-3-37(24-12-27-31-17(13-42(27)33(46)23(24)14-56-35(37)48)6-16-7-20(57-36(38)49)4-5-25(16)40-31)58-34(47)15(2)59-41-32-21-8-18(43(50)51)10-26(45(54)55)29(21)30-22(32)9-19(44(52)53)11-28(30)60-61-39;1-2-21(28)14-7-16-17-12(8-24(16)19(26)13(14)9-30-20(21)27)6-11-5-10(18(25)22-29)3-4-15(11)23-17;1-6(16(22)23)32-17-15-9-2-7(18(24)25)4-11(20(28)29)13(9)14-10(15)3-8(19(26)27)5-12(14)21(30)31/h4-12,15H,3,13-14,39H2,1-2H3;3-7,28H,2,8-9H2,1H3;2-6H,1H3,(H,22,23)/b41-32+;;/t15-,37-;21-;6-/m000/s1 |
| InChIKey | BRTHPTFCGVZXEU-IUVZZKBFSA-N |
| XLogP | 7.86 |
| TPSA | 656.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 39 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 123 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1682.89 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 39 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|