C24H18Cl2N4 — CID 158316901
azane;1-chlorododeca-2,4,6,8,10-pentayne;2-chloro-1,10-phenanthroline (PubChem CID 158316901) has the molecular formula C24H18Cl2N4 and a molecular weight of 433.34 g/mol. Its IUPAC name is azane;1-chlorododeca-2,4,6,8,10-pentayne;2-chloro-1,10-phenanthroline.
| Compound Name | azane;1-chlorododeca-2,4,6,8,10-pentayne;2-chloro-1,10-phenanthroline |
|---|---|
| PubChem CID | 158316901 |
| Molecular Formula | C24H18Cl2N4 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | azane;1-chlorododeca-2,4,6,8,10-pentayne;2-chloro-1,10-phenanthroline |
| SMILES | CC#CC#CC#CC#CC#CCCl.Clc1ccc2ccc3cccnc3c2n1.N.N |
| InChI | InChI=1S/C12H7ClN2.C12H5Cl.2H3N/c13-10-6-5-9-4-3-8-2-1-7-14-11(8)12(9)15-10;1-2-3-4-5-6-7-8-9-10-11-12-13;;/h1-7H;12H2,1H3;2*1H3 |
| InChIKey | RDRSEVVYTYHALE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|