C21H16N4OS — CID 15832223
N,4-diphenyl-5-phenylimino-1,3,4-thiadiazole-2-carboxamide (PubChem CID 15832223) has the molecular formula C21H16N4OS and a molecular weight of 372.45 g/mol. Its IUPAC name is N,4-diphenyl-5-phenylimino-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N,4-diphenyl-5-phenylimino-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 15832223 |
| Molecular Formula | C21H16N4OS |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N,4-diphenyl-5-phenylimino-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nn(-c2ccccc2)/c(=N/c2ccccc2)s1 |
| InChI | InChI=1S/C21H16N4OS/c26-19(22-16-10-4-1-5-11-16)20-24-25(18-14-8-3-9-15-18)21(27-20)23-17-12-6-2-7-13-17/h1-15H,(H,22,26)/b23-21- |
| InChIKey | MKYXZEDWXNMEFK-LNVKXUELSA-N |
| XLogP | 4.42 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |