C15H23NO2 — CID 158323447
1,3-dideuterio-2-[[4-(propylamino)phenyl]methyl]propane-1,3-dione;ethane (PubChem CID 158323447) has the molecular formula C15H23NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1,3-dideuterio-2-[[4-(propylamino)phenyl]methyl]propane-1,3-dione;ethane.
| Compound Name | 1,3-dideuterio-2-[[4-(propylamino)phenyl]methyl]propane-1,3-dione;ethane |
|---|---|
| PubChem CID | 158323447 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1,3-dideuterio-2-[[4-(propylamino)phenyl]methyl]propane-1,3-dione;ethane |
| SMILES | CC.[2H]C(=O)C(Cc1ccc(NCCC)cc1)C([2H])=O |
| InChI | InChI=1S/C13H17NO2.C2H6/c1-2-7-14-13-5-3-11(4-6-13)8-12(9-15)10-16;1-2/h3-6,9-10,12,14H,2,7-8H2,1H3;1-2H3/i9D,10D; |
| InChIKey | GPCWCEUAEOYJFL-AVDPWCIQSA-N |
| XLogP | 3.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|