C19H38OSn — CID 15832543
tributyl-[(5Z)-3,4,7,8-tetrahydro-2H-oxocin-2-yl]stannane (PubChem CID 15832543) has the molecular formula C19H38OSn and a molecular weight of 401.22 g/mol. Its IUPAC name is tributyl-[(5Z)-3,4,7,8-tetrahydro-2H-oxocin-2-yl]stannane.
| Compound Name | tributyl-[(5Z)-3,4,7,8-tetrahydro-2H-oxocin-2-yl]stannane |
|---|---|
| PubChem CID | 15832543 |
| Molecular Formula | C19H38OSn |
| Molecular Weight | 401.22 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | tributyl-[(5Z)-3,4,7,8-tetrahydro-2H-oxocin-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1CC/C=C\CCO1 |
| InChI | InChI=1S/C7H11O.3C4H9.Sn/c1-2-4-6-8-7-5-3-1;3*1-3-4-2;/h1-2,7H,3-6H2;3*1,3-4H2,2H3;/b2-1-;;;; |
| InChIKey | XJMSDMOEEZXXST-SQDRRJMKSA-N |
| XLogP | 6.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.22 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|