C15H30BrNSSn — CID 140619690
(4-bromo-2,3-dihydro-1,3-thiazol-2-yl)-tributylstannane (PubChem CID 140619690) has the molecular formula C15H30BrNSSn and a molecular weight of 455.09 g/mol. Its IUPAC name is (4-bromo-2,3-dihydro-1,3-thiazol-2-yl)-tributylstannane.
| Compound Name | (4-bromo-2,3-dihydro-1,3-thiazol-2-yl)-tributylstannane |
|---|---|
| PubChem CID | 140619690 |
| Molecular Formula | C15H30BrNSSn |
| Molecular Weight | 455.09 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | (4-bromo-2,3-dihydro-1,3-thiazol-2-yl)-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1NC(Br)=CS1 |
| InChI | InChI=1S/3C4H9.C3H3BrNS.Sn/c3*1-3-4-2;4-3-1-6-2-5-3;/h3*1,3-4H2,2H3;1-2,5H; |
| InChIKey | XXHNIJHYIGYFHI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.09 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|