C24H30O6 — CID 158330008
2,4-diethyl-5,7,10-tris(methoxymethyl)anthracene-1,8,9-triol (PubChem CID 158330008) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2,4-diethyl-5,7,10-tris(methoxymethyl)anthracene-1,8,9-triol.
| Compound Name | 2,4-diethyl-5,7,10-tris(methoxymethyl)anthracene-1,8,9-triol |
|---|---|
| PubChem CID | 158330008 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 2,4-diethyl-5,7,10-tris(methoxymethyl)anthracene-1,8,9-triol |
| SMILES | CCc1cc(CC)c2c(COC)c3c(COC)cc(COC)c(O)c3c(O)c2c1O |
| InChI | InChI=1S/C24H30O6/c1-6-13-8-14(7-2)22(25)20-18(13)17(12-30-5)19-15(10-28-3)9-16(11-29-4)23(26)21(19)24(20)27/h8-9,25-27H,6-7,10-12H2,1-5H3 |
| InChIKey | SBLKGVXJEQTVPV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|