C45H55N3O7S2 — CID 158359342
N-(2-amino-4,5-dimethylphenyl)-4-methylbenzenesulfonamide;N-[4,5-dimethyl-2-(2-oxopentyl)phenyl]-4-methylbenzenesulfonamide;phenyl butanoate (PubChem CID 158359342) has the molecular formula C45H55N3O7S2 and a molecular weight of 814.08 g/mol. Its IUPAC name is N-(2-amino-4,5-dimethylphenyl)-4-methylbenzenesulfonamide;N-[4,5-dimethyl-2-(2-oxopentyl)phenyl]-4-methylbenzenesulfonamide;phenyl butanoate.
| Compound Name | N-(2-amino-4,5-dimethylphenyl)-4-methylbenzenesulfonamide;N-[4,5-dimethyl-2-(2-oxopentyl)phenyl]-4-methylbenzenesulfonamide;phenyl butanoate |
|---|---|
| PubChem CID | 158359342 |
| Molecular Formula | C45H55N3O7S2 |
| Molecular Weight | 814.08 g/mol |
| Exact Mass | 813.35 |
| IUPAC Name | N-(2-amino-4,5-dimethylphenyl)-4-methylbenzenesulfonamide;N-[4,5-dimethyl-2-(2-oxopentyl)phenyl]-4-methylbenzenesulfonamide;phenyl butanoate |
| SMILES | CCCC(=O)Cc1cc(C)c(C)cc1NS(=O)(=O)c1ccc(C)cc1.CCCC(=O)Oc1ccccc1.Cc1ccc(S(=O)(=O)Nc2cc(C)c(C)cc2N)cc1 |
| InChI | InChI=1S/C20H25NO3S.C15H18N2O2S.C10H12O2/c1-5-6-18(22)13-17-11-15(3)16(4)12-20(17)21-25(23,24)19-9-7-14(2)8-10-19;1-10-4-6-13(7-5-10)20(18,19)17-15-9-12(3)11(2)8-14(15)16;1-2-6-10(11)12-9-7-4-3-5-8-9/h7-12,21H,5-6,13H2,1-4H3;4-9,17H,16H2,1-3H3;3-5,7-8H,2,6H2,1H3 |
| InChIKey | GTGVFWLABUKXGA-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 161.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.08 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|