C29H45N2O10PS — CID 158363817
(4-methyl-2-nitrophenyl) 6-[3-[6-[3,3-dimethylbutoxy(hydroxy)phosphoryl]oxyhexylsulfanyl]-2,5-dioxopyrrolidin-1-yl]hexanoate (PubChem CID 158363817) has the molecular formula C29H45N2O10PS and a molecular weight of 644.72 g/mol. Its IUPAC name is (4-methyl-2-nitrophenyl) 6-[3-[6-[3,3-dimethylbutoxy(hydroxy)phosphoryl]oxyhexylsulfanyl]-2,5-dioxopyrrolidin-1-yl]hexanoate.
| Compound Name | (4-methyl-2-nitrophenyl) 6-[3-[6-[3,3-dimethylbutoxy(hydroxy)phosphoryl]oxyhexylsulfanyl]-2,5-dioxopyrrolidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 158363817 |
| Molecular Formula | C29H45N2O10PS |
| Molecular Weight | 644.72 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | (4-methyl-2-nitrophenyl) 6-[3-[6-[3,3-dimethylbutoxy(hydroxy)phosphoryl]oxyhexylsulfanyl]-2,5-dioxopyrrolidin-1-yl]hexanoate |
| SMILES | Cc1ccc(OC(=O)CCCCCN2C(=O)CC(SCCCCCCOP(=O)(O)OCCC(C)(C)C)C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H45N2O10PS/c1-22-13-14-24(23(20-22)31(35)36)41-27(33)12-8-7-9-16-30-26(32)21-25(28(30)34)43-19-11-6-5-10-17-39-42(37,38)40-18-15-29(2,3)4/h13-14,20,25H,5-12,15-19,21H2,1-4H3,(H,37,38) |
| InChIKey | AUVWQBFGFWEZQG-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 162.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.72 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|