C27H24FN3O4S — CID 158364481
1-[4-(2-cyclopentylethynyl)-5-fluoro-2-methoxyphenyl]-2-methylidene-N-(1,2-oxazol-3-yl)quinoline-6-sulfonamide (PubChem CID 158364481) has the molecular formula C27H24FN3O4S and a molecular weight of 505.57 g/mol. Its IUPAC name is 1-[4-(2-cyclopentylethynyl)-5-fluoro-2-methoxyphenyl]-2-methylidene-N-(1,2-oxazol-3-yl)quinoline-6-sulfonamide.
| Compound Name | 1-[4-(2-cyclopentylethynyl)-5-fluoro-2-methoxyphenyl]-2-methylidene-N-(1,2-oxazol-3-yl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 158364481 |
| Molecular Formula | C27H24FN3O4S |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 1-[4-(2-cyclopentylethynyl)-5-fluoro-2-methoxyphenyl]-2-methylidene-N-(1,2-oxazol-3-yl)quinoline-6-sulfonamide |
| SMILES | C=C1C=Cc2cc(S(=O)(=O)Nc3ccon3)ccc2N1c1cc(F)c(C#CC2CCCC2)cc1OC |
| InChI | InChI=1S/C27H24FN3O4S/c1-18-7-9-21-15-22(36(32,33)30-27-13-14-35-29-27)11-12-24(21)31(18)25-17-23(28)20(16-26(25)34-2)10-8-19-5-3-4-6-19/h7,9,11-17,19H,1,3-6H2,2H3,(H,29,30) |
| InChIKey | GTVZTCZWOXAMMK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|