C9H8F6 — CID 15837044
2,3-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 15837044) has the molecular formula C9H8F6 and a molecular weight of 230.15 g/mol. Its IUPAC name is 2,3-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 2,3-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 15837044 |
| Molecular Formula | C9H8F6 |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2,3-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C2CCC1C2 |
| InChI | InChI=1S/C9H8F6/c10-8(11,12)6-4-1-2-5(3-4)7(6)9(13,14)15/h4-5H,1-3H2 |
| InChIKey | CRPBXNIGBMTJRY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|