About [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane
[(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane (PubChem CID 15497040) has the molecular formula C12H18F4
and a molecular weight of 238.27 g/mol. Its IUPAC name is [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane.
Analyze [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane?
The IUPAC name of [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane (CID 15497040) is [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane.
What is the SMILES notation for [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane?
The canonical SMILES for [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane is CCCC/C(=C(/F)C(F)(F)F)C1CCCC1.
What is the InChIKey of [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane?
The InChIKey is UXSNQGATCLRCAY-KHPPLWFESA-N. The full InChI is InChI=1S/C12H18F4/c1-2-3-8-10(9-6-4-5-7-9)11(13)12(14,15)16/h9H,2-8H2,1H3/b11-10-.
What are the key properties of [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane?
[(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane has a molecular weight of 238.27 g/mol, XLogP of 5.15, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,1,1,2-tetrafluorohept-2-en-3-yl]cyclopentane is sourced from PubChem (CID 15497040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).