C12H20F2 — CID 70937746
4,4-difluoro-1,2-di(propan-2-yl)cyclohexene (PubChem CID 70937746) has the molecular formula C12H20F2 and a molecular weight of 202.29 g/mol. Its IUPAC name is 4,4-difluoro-1,2-di(propan-2-yl)cyclohexene.
| Compound Name | 4,4-difluoro-1,2-di(propan-2-yl)cyclohexene |
|---|---|
| PubChem CID | 70937746 |
| Molecular Formula | C12H20F2 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 4,4-difluoro-1,2-di(propan-2-yl)cyclohexene |
| SMILES | CC(C)C1=C(C(C)C)CC(F)(F)CC1 |
| InChI | InChI=1S/C12H20F2/c1-8(2)10-5-6-12(13,14)7-11(10)9(3)4/h8-9H,5-7H2,1-4H3 |
| InChIKey | UKYATOVEUAOYSH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|