About 4-(trisulfanyl)phenol
4-(trisulfanyl)phenol (PubChem CID 158371834) has the molecular formula C6H6OS3
and a molecular weight of 190.31 g/mol. Its IUPAC name is 4-(trisulfanyl)phenol.
Molecular Properties
| Compound Name | 4-(trisulfanyl)phenol |
| PubChem CID | 158371834 |
| Molecular Formula | C6H6OS3 |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | 4-(trisulfanyl)phenol |
| SMILES | Oc1ccc(SSS)cc1 |
| InChI | InChI=1S/C6H6OS3/c7-5-1-3-6(4-2-5)9-10-8/h1-4,7-8H |
| InChIKey | CNSFYKQOLLXEDX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(trisulfanyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trisulfanyl)phenol?
The IUPAC name of 4-(trisulfanyl)phenol (CID 158371834) is 4-(trisulfanyl)phenol.
What is the SMILES notation for 4-(trisulfanyl)phenol?
The canonical SMILES for 4-(trisulfanyl)phenol is Oc1ccc(SSS)cc1.
What is the InChIKey of 4-(trisulfanyl)phenol?
The InChIKey is CNSFYKQOLLXEDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6OS3/c7-5-1-3-6(4-2-5)9-10-8/h1-4,7-8H.
What are the key properties of 4-(trisulfanyl)phenol?
4-(trisulfanyl)phenol has a molecular weight of 190.31 g/mol, XLogP of 2.98, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trisulfanyl)phenol is sourced from PubChem (CID 158371834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).