C16H28O2 — CID 15837288
(1R,3Z,5R,8R,9S)-8-methoxy-4,8,11,11-tetramethylbicyclo[7.2.0]undec-3-en-5-ol (PubChem CID 15837288) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is (1R,3Z,5R,8R,9S)-8-methoxy-4,8,11,11-tetramethylbicyclo[7.2.0]undec-3-en-5-ol.
| Compound Name | (1R,3Z,5R,8R,9S)-8-methoxy-4,8,11,11-tetramethylbicyclo[7.2.0]undec-3-en-5-ol |
|---|---|
| PubChem CID | 15837288 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | (1R,3Z,5R,8R,9S)-8-methoxy-4,8,11,11-tetramethylbicyclo[7.2.0]undec-3-en-5-ol |
| SMILES | CO[C@]1(C)CC[C@@H](O)/C(C)=C\C[C@@H]2[C@@H]1CC2(C)C |
| InChI | InChI=1S/C16H28O2/c1-11-6-7-12-13(10-15(12,2)3)16(4,18-5)9-8-14(11)17/h6,12-14,17H,7-10H2,1-5H3/b11-6-/t12-,13+,14-,16-/m1/s1 |
| InChIKey | MLLUZZWVSZOUFJ-WVNLMNQTSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|