C14H22O3 — CID 102274051
(2S,4R,4aS,8R,8aR)-4,7-dimethyl-2-[(E)-prop-1-enyl]-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol (PubChem CID 102274051) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (2S,4R,4aS,8R,8aR)-4,7-dimethyl-2-[(E)-prop-1-enyl]-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol.
| Compound Name | (2S,4R,4aS,8R,8aR)-4,7-dimethyl-2-[(E)-prop-1-enyl]-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol |
|---|---|
| PubChem CID | 102274051 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (2S,4R,4aS,8R,8aR)-4,7-dimethyl-2-[(E)-prop-1-enyl]-2,3,4a,5,8,8a-hexahydrochromene-4,8-diol |
| SMILES | C/C=C/[C@@H]1C[C@@](C)(O)[C@H]2CC=C(C)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C14H22O3/c1-4-5-10-8-14(3,16)11-7-6-9(2)12(15)13(11)17-10/h4-6,10-13,15-16H,7-8H2,1-3H3/b5-4+/t10-,11+,12-,13-,14-/m1/s1 |
| InChIKey | FPNCOZXZKKPMTQ-JVDHLBIQSA-N |
| XLogP | 1.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|