C36H58N2O7S — CID 158376744
5-[(1R,2S)-3-[(2S,6S)-6-(tert-butylsulfonylmethyl)-2-cyclohexyl-7-methyl-4-oxooctanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide (PubChem CID 158376744) has the molecular formula C36H58N2O7S and a molecular weight of 662.93 g/mol. Its IUPAC name is 5-[(1R,2S)-3-[(2S,6S)-6-(tert-butylsulfonylmethyl)-2-cyclohexyl-7-methyl-4-oxooctanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide.
| Compound Name | 5-[(1R,2S)-3-[(2S,6S)-6-(tert-butylsulfonylmethyl)-2-cyclohexyl-7-methyl-4-oxooctanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide |
|---|---|
| PubChem CID | 158376744 |
| Molecular Formula | C36H58N2O7S |
| Molecular Weight | 662.93 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | 5-[(1R,2S)-3-[(2S,6S)-6-(tert-butylsulfonylmethyl)-2-cyclohexyl-7-methyl-4-oxooctanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclopropylmethyl)-2,5-dioxopentanamide |
| SMILES | CC(C)[C@H](CC(=O)C[C@H](C(=O)N1CC2[C@@H]([C@H]1C(=O)CC(CC1CC1)C(=O)C(N)=O)C2(C)C)C1CCCCC1)CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C36H58N2O7S/c1-21(2)25(20-46(44,45)35(3,4)5)16-26(39)18-27(23-11-9-8-10-12-23)34(43)38-19-28-30(36(28,6)7)31(38)29(40)17-24(15-22-13-14-22)32(41)33(37)42/h21-25,27-28,30-31H,8-20H2,1-7H3,(H2,37,42)/t24?,25-,27+,28?,30+,31-/m1/s1 |
| InChIKey | LMVJLBXEJHRIHW-AOEHOSHUSA-N |
| XLogP | 4.93 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.93 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|