C19H16FN5S — CID 158376863
2-(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)-5-(1H-pyrrol-2-yl)-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 158376863) has the molecular formula C19H16FN5S and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)-5-(1H-pyrrol-2-yl)-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 2-(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)-5-(1H-pyrrol-2-yl)-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 158376863 |
| Molecular Formula | C19H16FN5S |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-(2-fluoro-6-pyrrolidin-1-yl-3-pyridinyl)-5-(1H-pyrrol-2-yl)-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | Fc1nc(N2CCCC2)ccc1-c1nc2nc(-c3ccc[nH]3)ccc2s1 |
| InChI | InChI=1S/C19H16FN5S/c20-17-12(5-8-16(23-17)25-10-1-2-11-25)19-24-18-15(26-19)7-6-14(22-18)13-4-3-9-21-13/h3-9,21H,1-2,10-11H2 |
| InChIKey | ORUPRRIJZDBPHW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|