C14H13F9NiO3S — CID 158378448
tert-butylbenzene;nickel(2+);1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 158378448) has the molecular formula C14H13F9NiO3S and a molecular weight of 491.00 g/mol. Its IUPAC name is tert-butylbenzene;nickel(2+);1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | tert-butylbenzene;nickel(2+);1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 158378448 |
| Molecular Formula | C14H13F9NiO3S |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | tert-butylbenzene;nickel(2+);1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CC(C)(C)c1cc[c-]cc1.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Ni+2] |
| InChI | InChI=1S/C10H13.C4HF9O3S.Ni/c1-10(2,3)9-7-5-4-6-8-9;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;/h5-8H,1-3H3;(H,14,15,16);/q-1;;+2/p-1 |
| InChIKey | DXRRPLBNJGVUPZ-UHFFFAOYSA-M |
| XLogP | 4.74 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|