C8H11FO3S — CID 174418404
1-fluoro-6,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 174418404) has the molecular formula C8H11FO3S and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-fluoro-6,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 1-fluoro-6,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 174418404 |
| Molecular Formula | C8H11FO3S |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 1-fluoro-6,6-dimethylcyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC1(C)C=CC=CC1(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H11FO3S/c1-7(2)5-3-4-6-8(7,9)13(10,11)12/h3-6H,1-2H3,(H,10,11,12) |
| InChIKey | QYPSPWZCJJSNEI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|