About sodium;tert-butylbenzene;trifluoromethanesulfonic acid
sodium;tert-butylbenzene;trifluoromethanesulfonic acid (PubChem CID 159497628) has the molecular formula C11H14F3NaO3S
and a molecular weight of 306.28 g/mol. Its IUPAC name is sodium;tert-butylbenzene;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | sodium;tert-butylbenzene;trifluoromethanesulfonic acid |
| PubChem CID | 159497628 |
| Molecular Formula | C11H14F3NaO3S |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | sodium;tert-butylbenzene;trifluoromethanesulfonic acid |
| SMILES | CC(C)(C)c1cc[c-]cc1.O=S(=O)(O)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C10H13.CHF3O3S.Na/c1-10(2,3)9-7-5-4-6-8-9;2-1(3,4)8(5,6)7;/h5-8H,1-3H3;(H,5,6,7);/q-1;;+1 |
| InChIKey | AUPAOZPPKKAAJF-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze sodium;tert-butylbenzene;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;tert-butylbenzene;trifluoromethanesulfonic acid?
The IUPAC name of sodium;tert-butylbenzene;trifluoromethanesulfonic acid (CID 159497628) is sodium;tert-butylbenzene;trifluoromethanesulfonic acid.
What is the SMILES notation for sodium;tert-butylbenzene;trifluoromethanesulfonic acid?
The canonical SMILES for sodium;tert-butylbenzene;trifluoromethanesulfonic acid is CC(C)(C)c1cc[c-]cc1.O=S(=O)(O)C(F)(F)F.[Na+].
What is the InChIKey of sodium;tert-butylbenzene;trifluoromethanesulfonic acid?
The InChIKey is AUPAOZPPKKAAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13.CHF3O3S.Na/c1-10(2,3)9-7-5-4-6-8-9;2-1(3,4)8(5,6)7;/h5-8H,1-3H3;(H,5,6,7);/q-1;;+1.
What are the key properties of sodium;tert-butylbenzene;trifluoromethanesulfonic acid?
sodium;tert-butylbenzene;trifluoromethanesulfonic acid has a molecular weight of 306.28 g/mol, XLogP of 0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;tert-butylbenzene;trifluoromethanesulfonic acid is sourced from PubChem (CID 159497628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).