C31H30ClN3O10S2 — CID 158378856
4-nitrobenzenesulfonamide;1-(4-nitrophenyl)sulfonyl-4-phenylbutan-2-one;3-phenylpropanoyl chloride (PubChem CID 158378856) has the molecular formula C31H30ClN3O10S2 and a molecular weight of 704.18 g/mol. Its IUPAC name is 4-nitrobenzenesulfonamide;1-(4-nitrophenyl)sulfonyl-4-phenylbutan-2-one;3-phenylpropanoyl chloride.
| Compound Name | 4-nitrobenzenesulfonamide;1-(4-nitrophenyl)sulfonyl-4-phenylbutan-2-one;3-phenylpropanoyl chloride |
|---|---|
| PubChem CID | 158378856 |
| Molecular Formula | C31H30ClN3O10S2 |
| Molecular Weight | 704.18 g/mol |
| Exact Mass | 703.11 |
| IUPAC Name | 4-nitrobenzenesulfonamide;1-(4-nitrophenyl)sulfonyl-4-phenylbutan-2-one;3-phenylpropanoyl chloride |
| SMILES | NS(=O)(=O)c1ccc([N+](=O)[O-])cc1.O=C(CCc1ccccc1)CS(=O)(=O)c1ccc([N+](=O)[O-])cc1.O=C(Cl)CCc1ccccc1 |
| InChI | InChI=1S/C16H15NO5S.C9H9ClO.C6H6N2O4S/c18-15(9-6-13-4-2-1-3-5-13)12-23(21,22)16-10-7-14(8-11-16)17(19)20;10-9(11)7-6-8-4-2-1-3-5-8;7-13(11,12)6-3-1-5(2-4-6)8(9)10/h1-5,7-8,10-11H,6,9,12H2;1-5H,6-7H2;1-4H,(H2,7,11,12) |
| InChIKey | GVNQPHGCVUUVFL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 214.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.18 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|