C13H16F2O4S — CID 158379615
(2,2-difluoro-3-phenylmethoxypropyl) cyclopropanesulfonate (PubChem CID 158379615) has the molecular formula C13H16F2O4S and a molecular weight of 306.33 g/mol. Its IUPAC name is (2,2-difluoro-3-phenylmethoxypropyl) cyclopropanesulfonate.
| Compound Name | (2,2-difluoro-3-phenylmethoxypropyl) cyclopropanesulfonate |
|---|---|
| PubChem CID | 158379615 |
| Molecular Formula | C13H16F2O4S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (2,2-difluoro-3-phenylmethoxypropyl) cyclopropanesulfonate |
| SMILES | O=S(=O)(OCC(F)(F)COCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C13H16F2O4S/c14-13(15,10-19-20(16,17)12-6-7-12)9-18-8-11-4-2-1-3-5-11/h1-5,12H,6-10H2 |
| InChIKey | GVPXSAKAQVGCEF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|