C18H26O6S — CID 159812642
[(2S)-1-cyclopropylsulfonyloxy-3-phenylmethoxypropan-2-yl] 2,2-dimethylpropanoate (PubChem CID 159812642) has the molecular formula C18H26O6S and a molecular weight of 370.47 g/mol. Its IUPAC name is [(2S)-1-cyclopropylsulfonyloxy-3-phenylmethoxypropan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-1-cyclopropylsulfonyloxy-3-phenylmethoxypropan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159812642 |
| Molecular Formula | C18H26O6S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | [(2S)-1-cyclopropylsulfonyloxy-3-phenylmethoxypropan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H](COCc1ccccc1)COS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C18H26O6S/c1-18(2,3)17(19)24-15(13-23-25(20,21)16-9-10-16)12-22-11-14-7-5-4-6-8-14/h4-8,15-16H,9-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | NLFLRLGGJIRHDQ-HNNXBMFYSA-N |
| XLogP | 2.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|