C19H14 — CID 158386191
pentacyclo[10.7.0.02,6.07,11.013,17]nonadeca-1,4,6,8,11,13(17),14,18-octaene (PubChem CID 158386191) has the molecular formula C19H14 and a molecular weight of 242.32 g/mol. Its IUPAC name is pentacyclo[10.7.0.02,6.07,11.013,17]nonadeca-1,4,6,8,11,13(17),14,18-octaene.
| Compound Name | pentacyclo[10.7.0.02,6.07,11.013,17]nonadeca-1,4,6,8,11,13(17),14,18-octaene |
|---|---|
| PubChem CID | 158386191 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | pentacyclo[10.7.0.02,6.07,11.013,17]nonadeca-1,4,6,8,11,13(17),14,18-octaene |
| SMILES | C1=Cc2c(ccc3c4c(c5c(c23)CC=C5)C=CC4)C1 |
| InChI | InChI=1S/C19H14/c1-4-12-10-11-18-16-7-2-6-14(16)15-8-3-9-17(15)19(18)13(12)5-1/h1-3,5-6,8,10-11H,4,7,9H2 |
| InChIKey | WIVZWNGXJGNBFH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |