C22H20F3O2S+ — CID 158389401
diphenyl-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)phenyl]sulfanium (PubChem CID 158389401) has the molecular formula C22H20F3O2S+ and a molecular weight of 405.46 g/mol. Its IUPAC name is diphenyl-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)phenyl]sulfanium.
| Compound Name | diphenyl-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 158389401 |
| Molecular Formula | C22H20F3O2S+ |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | diphenyl-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)phenyl]sulfanium |
| SMILES | CC(O)(COc1ccccc1[S+](c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H20F3O2S/c1-21(26,22(23,24)25)16-27-19-14-8-9-15-20(19)28(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15,26H,16H2,1H3/q+1 |
| InChIKey | GAFLJSPWAUGKFH-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|